C6H4Cl3NO — CID 137440849
1-(2,3,4-trichloropyrrol-1-yl)ethanone (PubChem CID 137440849) has the molecular formula C6H4Cl3NO and a molecular weight of 212.46 g/mol. Its IUPAC name is 1-(2,3,4-trichloropyrrol-1-yl)ethanone.
| Compound Name | 1-(2,3,4-trichloropyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 137440849 |
| Molecular Formula | C6H4Cl3NO |
| Molecular Weight | 212.46 g/mol |
| Exact Mass | 210.94 |
| IUPAC Name | 1-(2,3,4-trichloropyrrol-1-yl)ethanone |
| SMILES | CC(=O)n1cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C6H4Cl3NO/c1-3(11)10-2-4(7)5(8)6(10)9/h2H,1H3 |
| InChIKey | JZOJPBYMPYORKA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |