C10H7Cl2NO2 — CID 18699537
1-(4,6-dichloro-3-hydroxyindol-1-yl)ethanone (PubChem CID 18699537) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is 1-(4,6-dichloro-3-hydroxyindol-1-yl)ethanone.
| Compound Name | 1-(4,6-dichloro-3-hydroxyindol-1-yl)ethanone |
|---|---|
| PubChem CID | 18699537 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 1-(4,6-dichloro-3-hydroxyindol-1-yl)ethanone |
| SMILES | CC(=O)n1cc(O)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C10H7Cl2NO2/c1-5(14)13-4-9(15)10-7(12)2-6(11)3-8(10)13/h2-4,15H,1H3 |
| InChIKey | HWNYXNGBIJJROQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |