C12H8Cl3NO2 — CID 82269588
(E)-3-(2,4,6-trichloro-1-methylindol-3-yl)prop-2-enoic acid (PubChem CID 82269588) has the molecular formula C12H8Cl3NO2 and a molecular weight of 304.56 g/mol. Its IUPAC name is (E)-3-(2,4,6-trichloro-1-methylindol-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(2,4,6-trichloro-1-methylindol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82269588 |
| Molecular Formula | C12H8Cl3NO2 |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | (E)-3-(2,4,6-trichloro-1-methylindol-3-yl)prop-2-enoic acid |
| SMILES | Cn1c(Cl)c(/C=C/C(=O)O)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C12H8Cl3NO2/c1-16-9-5-6(13)4-8(14)11(9)7(12(16)15)2-3-10(17)18/h2-5H,1H3,(H,17,18)/b3-2+ |
| InChIKey | CJJMCERNWIZRPM-NSCUHMNNSA-N |
| XLogP | 4.24 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|