C12H10Cl3NO2 — CID 82269607
2,4,6-trichloro-1-(2-methoxyethyl)indole-3-carbaldehyde (PubChem CID 82269607) has the molecular formula C12H10Cl3NO2 and a molecular weight of 306.58 g/mol. Its IUPAC name is 2,4,6-trichloro-1-(2-methoxyethyl)indole-3-carbaldehyde.
| Compound Name | 2,4,6-trichloro-1-(2-methoxyethyl)indole-3-carbaldehyde |
|---|---|
| PubChem CID | 82269607 |
| Molecular Formula | C12H10Cl3NO2 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | 2,4,6-trichloro-1-(2-methoxyethyl)indole-3-carbaldehyde |
| SMILES | COCCn1c(Cl)c(C=O)c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C12H10Cl3NO2/c1-18-3-2-16-10-5-7(13)4-9(14)11(10)8(6-17)12(16)15/h4-6H,2-3H2,1H3 |
| InChIKey | ZAVBEUURIUVNMV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|