C16H18ClNO3 — CID 82269173
(E)-3-[2-chloro-1-(2-methoxyethyl)-4,6-dimethylindol-3-yl]prop-2-enoic acid (PubChem CID 82269173) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is (E)-3-[2-chloro-1-(2-methoxyethyl)-4,6-dimethylindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-1-(2-methoxyethyl)-4,6-dimethylindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 82269173 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (E)-3-[2-chloro-1-(2-methoxyethyl)-4,6-dimethylindol-3-yl]prop-2-enoic acid |
| SMILES | COCCn1c(Cl)c(/C=C/C(=O)O)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C16H18ClNO3/c1-10-8-11(2)15-12(4-5-14(19)20)16(17)18(6-7-21-3)13(15)9-10/h4-5,8-9H,6-7H2,1-3H3,(H,19,20)/b5-4+ |
| InChIKey | WFTPYSNGACYOSV-SNAWJCMRSA-N |
| XLogP | 3.66 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|