C10H8Cl3IO4 — CID 15355744
[acetyloxy-(2,4,6-trichlorophenyl)-lambda3-iodanyl] acetate (PubChem CID 15355744) has the molecular formula C10H8Cl3IO4 and a molecular weight of 425.43 g/mol. Its IUPAC name is [acetyloxy-(2,4,6-trichlorophenyl)-lambda3-iodanyl] acetate.
| Compound Name | [acetyloxy-(2,4,6-trichlorophenyl)-lambda3-iodanyl] acetate |
|---|---|
| PubChem CID | 15355744 |
| Molecular Formula | C10H8Cl3IO4 |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 423.85 |
| IUPAC Name | [acetyloxy-(2,4,6-trichlorophenyl)-lambda3-iodanyl] acetate |
| SMILES | CC(=O)OI(OC(C)=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H8Cl3IO4/c1-5(15)17-14(18-6(2)16)10-8(12)3-7(11)4-9(10)13/h3-4H,1-2H3 |
| InChIKey | OZVPVEQLEDCRTM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|