C20H22N2O6S2 — CID 137440982
N-hydroxy-4-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 137440982) has the molecular formula C20H22N2O6S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-hydroxy-4-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 137440982 |
| Molecular Formula | C20H22N2O6S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | N-hydroxy-4-[2-[4-[(1S,2S)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2cc(C#CC#C[C@H]3C[C@@H]3CO)sc2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C20H22N2O6S2/c1-20(19(25)21-26,30(2,27)28)7-8-22-11-14-10-16(29-17(14)18(22)24)6-4-3-5-13-9-15(13)12-23/h10,13,15,23,26H,7-9,11-12H2,1-2H3,(H,21,25)/t13-,15+,20?/m0/s1 |
| InChIKey | FWOMEOOMZSWKEC-VOXKTVDUSA-N |
| XLogP | 0.39 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|