C21H25N3O6S2 — CID 137440942
N-hydroxy-4-[2-[4-[1-(2-hydroxyethyl)azetidin-3-yl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 137440942) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-hydroxy-4-[2-[4-[1-(2-hydroxyethyl)azetidin-3-yl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[2-[4-[1-(2-hydroxyethyl)azetidin-3-yl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 137440942 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-hydroxy-4-[2-[4-[1-(2-hydroxyethyl)azetidin-3-yl]buta-1,3-diynyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCN1Cc2cc(C#CC#CC3CN(CCO)C3)sc2C1=O)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H25N3O6S2/c1-21(20(27)22-28,32(2,29)30)7-8-24-14-16-11-17(31-18(16)19(24)26)6-4-3-5-15-12-23(13-15)9-10-25/h11,15,25,28H,7-10,12-14H2,1-2H3,(H,22,27) |
| InChIKey | PYQGOTCTXBAHJA-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|