C23H27N3O5S2 — CID 139578380
N-hydroxy-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 139578380) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-hydroxy-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 139578380 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-hydroxy-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCc1nc2ccc(C#CC#CC3CN(CCCO)C3)cc2s1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C23H27N3O5S2/c1-23(22(28)25-29,33(2,30)31)11-10-21-24-19-9-8-17(14-20(19)32-21)6-3-4-7-18-15-26(16-18)12-5-13-27/h8-9,14,18,27,29H,5,10-13,15-16H2,1-2H3,(H,25,28) |
| InChIKey | USWRHZSPSNDXNH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|