C23H27N3O5S2 — CID 139578378
(2R)-2-(hydroxycarbamoyl)-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methylbutane-1-sulfinic acid (PubChem CID 139578378) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (2R)-2-(hydroxycarbamoyl)-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methylbutane-1-sulfinic acid.
| Compound Name | (2R)-2-(hydroxycarbamoyl)-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methylbutane-1-sulfinic acid |
|---|---|
| PubChem CID | 139578378 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | (2R)-2-(hydroxycarbamoyl)-4-[6-[4-[1-(3-hydroxypropyl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methylbutane-1-sulfinic acid |
| SMILES | C[C@](CCc1nc2ccc(C#CC#CC3CN(CCCO)C3)cc2s1)(CS(=O)O)C(=O)NO |
| InChI | InChI=1S/C23H27N3O5S2/c1-23(16-33(30)31,22(28)25-29)10-9-21-24-19-8-7-17(13-20(19)32-21)5-2-3-6-18-14-26(15-18)11-4-12-27/h7-8,13,18,27,29H,4,9-12,14-16H2,1H3,(H,25,28)(H,30,31)/t23-/m0/s1 |
| InChIKey | NOAQFTOBXPAMHZ-QHCPKHFHSA-N |
| XLogP | 1.63 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|