C23H24N3O5S2- — CID 139578403
(2R)-2-(hydroxycarbamoyl)-2-methyl-4-[6-[4-[1-(oxetan-3-yl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]butane-1-sulfinate (PubChem CID 139578403) has the molecular formula C23H24N3O5S2- and a molecular weight of 486.60 g/mol. Its IUPAC name is (2R)-2-(hydroxycarbamoyl)-2-methyl-4-[6-[4-[1-(oxetan-3-yl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]butane-1-sulfinate.
| Compound Name | (2R)-2-(hydroxycarbamoyl)-2-methyl-4-[6-[4-[1-(oxetan-3-yl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]butane-1-sulfinate |
|---|---|
| PubChem CID | 139578403 |
| Molecular Formula | C23H24N3O5S2- |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2R)-2-(hydroxycarbamoyl)-2-methyl-4-[6-[4-[1-(oxetan-3-yl)azetidin-3-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]butane-1-sulfinate |
| SMILES | C[C@](CCc1nc2ccc(C#CC#CC3CN(C4COC4)C3)cc2s1)(CS(=O)[O-])C(=O)NO |
| InChI | InChI=1S/C23H25N3O5S2/c1-23(15-33(29)30,22(27)25-28)9-8-21-24-19-7-6-16(10-20(19)32-21)4-2-3-5-17-11-26(12-17)18-13-31-14-18/h6-7,10,17-18,28H,8-9,11-15H2,1H3,(H,25,27)(H,29,30)/p-1/t23-/m0/s1 |
| InChIKey | IQBOEWUHKQBFGJ-QHCPKHFHSA-M |
| XLogP | 1.31 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|