C24H27N3O6S2 — CID 121350959
N-hydroxy-4-[6-[4-[1-(2-hydroxyacetyl)piperidin-4-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide (PubChem CID 121350959) has the molecular formula C24H27N3O6S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-hydroxy-4-[6-[4-[1-(2-hydroxyacetyl)piperidin-4-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | N-hydroxy-4-[6-[4-[1-(2-hydroxyacetyl)piperidin-4-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 121350959 |
| Molecular Formula | C24H27N3O6S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | N-hydroxy-4-[6-[4-[1-(2-hydroxyacetyl)piperidin-4-yl]buta-1,3-diynyl]-1,3-benzothiazol-2-yl]-2-methyl-2-methylsulfonylbutanamide |
| SMILES | CC(CCc1nc2ccc(C#CC#CC3CCN(C(=O)CO)CC3)cc2s1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C24H27N3O6S2/c1-24(23(30)26-31,35(2,32)33)12-9-21-25-19-8-7-18(15-20(19)34-21)6-4-3-5-17-10-13-27(14-11-17)22(29)16-28/h7-8,15,17,28,31H,9-14,16H2,1-2H3,(H,26,30) |
| InChIKey | YWDOJLUETXYTKH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|