C14H18N2O2S — CID 166230534
2-[(3,5-dimethylmorpholin-4-yl)methyl]-1,3-benzothiazol-6-ol (PubChem CID 166230534) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-[(3,5-dimethylmorpholin-4-yl)methyl]-1,3-benzothiazol-6-ol.
| Compound Name | 2-[(3,5-dimethylmorpholin-4-yl)methyl]-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 166230534 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[(3,5-dimethylmorpholin-4-yl)methyl]-1,3-benzothiazol-6-ol |
| SMILES | CC1COCC(C)N1Cc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-9-7-18-8-10(2)16(9)6-14-15-12-4-3-11(17)5-13(12)19-14/h3-5,9-10,17H,6-8H2,1-2H3 |
| InChIKey | SLQNXDILCBXHGY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |