C27H29ClN4O4 — CID 137444106
2-[[[2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetyl]amino]methyl]benzoic acid (PubChem CID 137444106) has the molecular formula C27H29ClN4O4 and a molecular weight of 509.01 g/mol. Its IUPAC name is 2-[[[2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetyl]amino]methyl]benzoic acid.
| Compound Name | 2-[[[2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 137444106 |
| Molecular Formula | C27H29ClN4O4 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-[[[2-[2-(4-chlorophenyl)-4-oxo-7-pentyl-6,7-dihydropyrazolo[1,5-a]pyrazin-5-yl]acetyl]amino]methyl]benzoic acid |
| SMILES | CCCCCC1CN(CC(=O)NCc2ccccc2C(=O)O)C(=O)c2cc(-c3ccc(Cl)cc3)nn21 |
| InChI | InChI=1S/C27H29ClN4O4/c1-2-3-4-8-21-16-31(17-25(33)29-15-19-7-5-6-9-22(19)27(35)36)26(34)24-14-23(30-32(21)24)18-10-12-20(28)13-11-18/h5-7,9-14,21H,2-4,8,15-17H2,1H3,(H,29,33)(H,35,36) |
| InChIKey | UCLZJXKIFVIQLO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|