C27H42O3 — CID 137446039
(1S,2S,4S,6R,7S,8R,9S,12S,13R,18R,20S)-5',7,9,13-tetramethylspiro[5,19-dioxahexacyclo[10.9.0.02,9.04,8.013,18.018,20]henicosane-6,2'-oxane] (PubChem CID 137446039) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is (1S,2S,4S,6R,7S,8R,9S,12S,13R,18R,20S)-5',7,9,13-tetramethylspiro[5,19-dioxahexacyclo[10.9.0.02,9.04,8.013,18.018,20]henicosane-6,2'-oxane].
| Compound Name | (1S,2S,4S,6R,7S,8R,9S,12S,13R,18R,20S)-5',7,9,13-tetramethylspiro[5,19-dioxahexacyclo[10.9.0.02,9.04,8.013,18.018,20]henicosane-6,2'-oxane] |
|---|---|
| PubChem CID | 137446039 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | (1S,2S,4S,6R,7S,8R,9S,12S,13R,18R,20S)-5',7,9,13-tetramethylspiro[5,19-dioxahexacyclo[10.9.0.02,9.04,8.013,18.018,20]henicosane-6,2'-oxane] |
| SMILES | CC1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4C[C@@H]5O[C@@]56CCCC[C@]6(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C27H42O3/c1-16-7-12-27(28-15-16)17(2)23-21(29-27)14-20-18-13-22-26(30-22)10-6-5-9-25(26,4)19(18)8-11-24(20,23)3/h16-23H,5-15H2,1-4H3/t16?,17-,18+,19-,20-,21-,22-,23-,24-,25+,26-,27+/m0/s1 |
| InChIKey | AZDBDDHJMBLAKK-LGKFUYQZSA-N |
| XLogP | 5.95 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|