C27H44O6 — CID 155486513
(6R,7S,9S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,18,19-tetrol (PubChem CID 155486513) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is (6R,7S,9S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,18,19-tetrol.
| Compound Name | (6R,7S,9S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,18,19-tetrol |
|---|---|
| PubChem CID | 155486513 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (6R,7S,9S,13R,15R,16R,18R,19R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-15,16,18,19-tetrol |
| SMILES | CC1CC[C@@]2(OC1)OC1CC3C4C[C@@H](O)[C@@]5(O)C[C@@H](O)[C@H](O)C[C@]5(C)C4CC[C@]3(C)C1C2C |
| InChI | InChI=1S/C27H44O6/c1-14-5-8-27(32-13-14)15(2)23-21(33-27)10-18-16-9-22(30)26(31)12-20(29)19(28)11-25(26,4)17(16)6-7-24(18,23)3/h14-23,28-31H,5-13H2,1-4H3/t14?,15?,16?,17?,18?,19-,20-,21?,22-,23?,24+,25-,26+,27-/m1/s1 |
| InChIKey | JASYOPOIUHUBJK-HUDWNKMPSA-N |
| XLogP | 2.85 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |