C24H29N5S — CID 137446248
4-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(3-methylbutylamino)sulfanylphenyl]pyrimidin-2-amine (PubChem CID 137446248) has the molecular formula C24H29N5S and a molecular weight of 419.60 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(3-methylbutylamino)sulfanylphenyl]pyrimidin-2-amine.
| Compound Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(3-methylbutylamino)sulfanylphenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137446248 |
| Molecular Formula | C24H29N5S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-(3,4-dihydro-2H-quinolin-1-yl)-N-[4-(3-methylbutylamino)sulfanylphenyl]pyrimidin-2-amine |
| SMILES | CC(C)CCNSc1ccc(Nc2nccc(N3CCCc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C24H29N5S/c1-18(2)13-16-26-30-21-11-9-20(10-12-21)27-24-25-15-14-23(28-24)29-17-5-7-19-6-3-4-8-22(19)29/h3-4,6,8-12,14-15,18,26H,5,7,13,16-17H2,1-2H3,(H,25,27,28) |
| InChIKey | YISWOBRJKYGLFB-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|