C25H26ClN3O5S — CID 137447581
6-[(4-tert-butylphenyl)sulfonylamino]-3-chloro-N-formyl-2-methyl-N-(4-methyl-2-oxo-1H-pyridin-3-yl)benzamide (PubChem CID 137447581) has the molecular formula C25H26ClN3O5S and a molecular weight of 516.02 g/mol. Its IUPAC name is 6-[(4-tert-butylphenyl)sulfonylamino]-3-chloro-N-formyl-2-methyl-N-(4-methyl-2-oxo-1H-pyridin-3-yl)benzamide.
| Compound Name | 6-[(4-tert-butylphenyl)sulfonylamino]-3-chloro-N-formyl-2-methyl-N-(4-methyl-2-oxo-1H-pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 137447581 |
| Molecular Formula | C25H26ClN3O5S |
| Molecular Weight | 516.02 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 6-[(4-tert-butylphenyl)sulfonylamino]-3-chloro-N-formyl-2-methyl-N-(4-methyl-2-oxo-1H-pyridin-3-yl)benzamide |
| SMILES | Cc1cc[nH]c(=O)c1N(C=O)C(=O)c1c(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)ccc(Cl)c1C |
| InChI | InChI=1S/C25H26ClN3O5S/c1-15-12-13-27-23(31)22(15)29(14-30)24(32)21-16(2)19(26)10-11-20(21)28-35(33,34)18-8-6-17(7-9-18)25(3,4)5/h6-14,28H,1-5H3,(H,27,31) |
| InChIKey | MNIAQWGYIKQCMZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.02 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|