C10H14N2O2 — CID 137449428
1-[(1S,2R)-2-hydroxycyclobutyl]-3-(methylamino)pyridin-2-one (PubChem CID 137449428) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-[(1S,2R)-2-hydroxycyclobutyl]-3-(methylamino)pyridin-2-one.
| Compound Name | 1-[(1S,2R)-2-hydroxycyclobutyl]-3-(methylamino)pyridin-2-one |
|---|---|
| PubChem CID | 137449428 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-[(1S,2R)-2-hydroxycyclobutyl]-3-(methylamino)pyridin-2-one |
| SMILES | CNc1cccn([C@H]2CC[C@H]2O)c1=O |
| InChI | InChI=1S/C10H14N2O2/c1-11-7-3-2-6-12(10(7)14)8-4-5-9(8)13/h2-3,6,8-9,11,13H,4-5H2,1H3/t8-,9+/m0/s1 |
| InChIKey | NTDOQBBAKCHLOF-DTWKUNHWSA-N |
| XLogP | 0.59 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |