C9H12N2O2 — CID 137450803
3-amino-1-[(1R,2R)-2-hydroxycyclobutyl]pyridin-2-one (PubChem CID 137450803) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-amino-1-[(1R,2R)-2-hydroxycyclobutyl]pyridin-2-one.
| Compound Name | 3-amino-1-[(1R,2R)-2-hydroxycyclobutyl]pyridin-2-one |
|---|---|
| PubChem CID | 137450803 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-amino-1-[(1R,2R)-2-hydroxycyclobutyl]pyridin-2-one |
| SMILES | Nc1cccn([C@@H]2CC[C@H]2O)c1=O |
| InChI | InChI=1S/C9H12N2O2/c10-6-2-1-5-11(9(6)13)7-3-4-8(7)12/h1-2,5,7-8,12H,3-4,10H2/t7-,8-/m1/s1 |
| InChIKey | CSPYUDMVNYSUNY-HTQZYQBOSA-N |
| XLogP | 0.13 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |