C17H19NO6S — CID 137451112
[3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate (PubChem CID 137451112) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is [3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate.
| Compound Name | [3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 137451112 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | [3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] sulfamate |
| SMILES | COc1cc(/C=C\c2cccc(OS(N)(=O)=O)c2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO6S/c1-21-15-10-13(11-16(22-2)17(15)23-3)8-7-12-5-4-6-14(9-12)24-25(18,19)20/h4-11H,1-3H3,(H2,18,19,20)/b8-7- |
| InChIKey | NRDKGBJZQNDFEK-FPLPWBNLSA-N |
| XLogP | 2.47 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|