C17H18N2O4S — CID 137451562
5-butyl-8-methylsulfonylpyrido[3,2-b][1,4]benzoxazepin-6-one (PubChem CID 137451562) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 5-butyl-8-methylsulfonylpyrido[3,2-b][1,4]benzoxazepin-6-one.
| Compound Name | 5-butyl-8-methylsulfonylpyrido[3,2-b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 137451562 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 5-butyl-8-methylsulfonylpyrido[3,2-b][1,4]benzoxazepin-6-one |
| SMILES | CCCCN1C(=O)c2cc(S(C)(=O)=O)ccc2Oc2cccnc21 |
| InChI | InChI=1S/C17H18N2O4S/c1-3-4-10-19-16-15(6-5-9-18-16)23-14-8-7-12(24(2,21)22)11-13(14)17(19)20/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | NRCOKNMHJZFRBF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |