C20H15N3O6S — CID 53173550
N-(1,3-benzodioxol-5-yl)-5-methyl-6-oxopyrido[3,2-b][1,4]benzoxazepine-8-sulfonamide (PubChem CID 53173550) has the molecular formula C20H15N3O6S and a molecular weight of 425.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-methyl-6-oxopyrido[3,2-b][1,4]benzoxazepine-8-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-methyl-6-oxopyrido[3,2-b][1,4]benzoxazepine-8-sulfonamide |
|---|---|
| PubChem CID | 53173550 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-methyl-6-oxopyrido[3,2-b][1,4]benzoxazepine-8-sulfonamide |
| SMILES | CN1C(=O)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCO4)ccc2Oc2cccnc21 |
| InChI | InChI=1S/C20H15N3O6S/c1-23-19-17(3-2-8-21-19)29-15-7-5-13(10-14(15)20(23)24)30(25,26)22-12-4-6-16-18(9-12)28-11-27-16/h2-10,22H,11H2,1H3 |
| InChIKey | UXHUCHKYPIYHML-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_C(5)', 'substructure': 'N/A'} |
|---|