C14H20N2 — CID 137453464
5-ethenyl-2-(3-propylpyrrolidin-1-yl)pyridine (PubChem CID 137453464) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 5-ethenyl-2-(3-propylpyrrolidin-1-yl)pyridine.
| Compound Name | 5-ethenyl-2-(3-propylpyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 137453464 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 5-ethenyl-2-(3-propylpyrrolidin-1-yl)pyridine |
| SMILES | C=Cc1ccc(N2CCC(CCC)C2)nc1 |
| InChI | InChI=1S/C14H20N2/c1-3-5-13-8-9-16(11-13)14-7-6-12(4-2)10-15-14/h4,6-7,10,13H,2-3,5,8-9,11H2,1H3 |
| InChIKey | XMKHWWCPMPEEJB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |