C26H32N4O3 — CID 137457101
7-[4-[4-amino-5-[(4-methoxyphenyl)iminomethyl]-3,6-dihydro-2H-pyridin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 137457101) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 7-[4-[4-amino-5-[(4-methoxyphenyl)iminomethyl]-3,6-dihydro-2H-pyridin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-amino-5-[(4-methoxyphenyl)iminomethyl]-3,6-dihydro-2H-pyridin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 137457101 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 7-[4-[4-amino-5-[(4-methoxyphenyl)iminomethyl]-3,6-dihydro-2H-pyridin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1ccc(/N=C/C2=C(N)CCN(CCCCOc3ccc4c(c3)NC(=O)CC4)C2)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-32-22-9-6-21(7-10-22)28-17-20-18-30(14-12-24(20)27)13-2-3-15-33-23-8-4-19-5-11-26(31)29-25(19)16-23/h4,6-10,16-17H,2-3,5,11-15,18,27H2,1H3,(H,29,31)/b28-17+ |
| InChIKey | FHGKAZZTBBVCIB-OGLMXYFKSA-N |
| XLogP | 4.06 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|