C25H29N3O2 — CID 175505645
7-[4-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 175505645) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 7-[4-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 175505645 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 7-[4-(5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-2-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cn1c2c(c3ccccc31)CN(CCCCOc1ccc3c(c1)NC(=O)CC3)CC2 |
| InChI | InChI=1S/C25H29N3O2/c1-27-23-7-3-2-6-20(23)21-17-28(14-12-24(21)27)13-4-5-15-30-19-10-8-18-9-11-25(29)26-22(18)16-19/h2-3,6-8,10,16H,4-5,9,11-15,17H2,1H3,(H,26,29) |
| InChIKey | AWQZADSBPMNPCR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|