C27H30N6O — CID 137457445
5-methyl-1-[1-[[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide (PubChem CID 137457445) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 5-methyl-1-[1-[[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-1-[1-[[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 137457445 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 5-methyl-1-[1-[[4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)nn1-c1ccc2c(ccn2Cc2ccc(N3CC4CN(C)CC4C3)cc2)c1 |
| InChI | InChI=1S/C27H30N6O/c1-18-11-25(27(28)34)29-33(18)24-7-8-26-20(12-24)9-10-31(26)13-19-3-5-23(6-4-19)32-16-21-14-30(2)15-22(21)17-32/h3-12,21-22H,13-17H2,1-2H3,(H2,28,34) |
| InChIKey | ZQKJICDAPFOYSV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|