C26H23N5O3S — CID 137497546
5-methyl-1-[1-[[4-(3-sulfamoylphenyl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide (PubChem CID 137497546) has the molecular formula C26H23N5O3S and a molecular weight of 485.57 g/mol. Its IUPAC name is 5-methyl-1-[1-[[4-(3-sulfamoylphenyl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide.
| Compound Name | 5-methyl-1-[1-[[4-(3-sulfamoylphenyl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 137497546 |
| Molecular Formula | C26H23N5O3S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 5-methyl-1-[1-[[4-(3-sulfamoylphenyl)phenyl]methyl]indol-5-yl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)nn1-c1ccc2c(ccn2Cc2ccc(-c3cccc(S(N)(=O)=O)c3)cc2)c1 |
| InChI | InChI=1S/C26H23N5O3S/c1-17-13-24(26(27)32)29-31(17)22-9-10-25-21(14-22)11-12-30(25)16-18-5-7-19(8-6-18)20-3-2-4-23(15-20)35(28,33)34/h2-15H,16H2,1H3,(H2,27,32)(H2,28,33,34) |
| InChIKey | UWBUSUYIVNFXOX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |