C11H16FN3O — CID 137457535
3-amino-5-fluoro-1-(1-methylpiperidin-4-yl)pyridin-2-one (PubChem CID 137457535) has the molecular formula C11H16FN3O and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-amino-5-fluoro-1-(1-methylpiperidin-4-yl)pyridin-2-one.
| Compound Name | 3-amino-5-fluoro-1-(1-methylpiperidin-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 137457535 |
| Molecular Formula | C11H16FN3O |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 3-amino-5-fluoro-1-(1-methylpiperidin-4-yl)pyridin-2-one |
| SMILES | CN1CCC(n2cc(F)cc(N)c2=O)CC1 |
| InChI | InChI=1S/C11H16FN3O/c1-14-4-2-9(3-5-14)15-7-8(12)6-10(13)11(15)16/h6-7,9H,2-5,13H2,1H3 |
| InChIKey | BOOYHTBBBKTDDP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |