C9H13N3O — CID 137457656
3-amino-1-[(1S,2S)-2-aminocyclobutyl]pyridin-2-one (PubChem CID 137457656) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-amino-1-[(1S,2S)-2-aminocyclobutyl]pyridin-2-one.
| Compound Name | 3-amino-1-[(1S,2S)-2-aminocyclobutyl]pyridin-2-one |
|---|---|
| PubChem CID | 137457656 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-amino-1-[(1S,2S)-2-aminocyclobutyl]pyridin-2-one |
| SMILES | Nc1cccn([C@H]2CC[C@@H]2N)c1=O |
| InChI | InChI=1S/C9H13N3O/c10-6-3-4-8(6)12-5-1-2-7(11)9(12)13/h1-2,5-6,8H,3-4,10-11H2/t6-,8-/m0/s1 |
| InChIKey | GESQNSOOVHBIQH-XPUUQOCRSA-N |
| XLogP | 0.09 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |