C9H13ClN2O2 — CID 162308207
3-amino-1-[(2S)-2-hydroxycyclobutyl]pyridin-2-one;hydrochloride (PubChem CID 162308207) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 3-amino-1-[(2S)-2-hydroxycyclobutyl]pyridin-2-one;hydrochloride.
| Compound Name | 3-amino-1-[(2S)-2-hydroxycyclobutyl]pyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 162308207 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-amino-1-[(2S)-2-hydroxycyclobutyl]pyridin-2-one;hydrochloride |
| SMILES | Cl.Nc1cccn(C2CC[C@@H]2O)c1=O |
| InChI | InChI=1S/C9H12N2O2.ClH/c10-6-2-1-5-11(9(6)13)7-3-4-8(7)12;/h1-2,5,7-8,12H,3-4,10H2;1H/t7?,8-;/m0./s1 |
| InChIKey | SELPOKSCIDHCIQ-MTICXXPYSA-N |
| XLogP | 0.55 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |