C10H13NO2 — CID 166507271
1-[(2S)-2-hydroxycyclobutyl]-3-methylpyridin-2-one (PubChem CID 166507271) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxycyclobutyl]-3-methylpyridin-2-one.
| Compound Name | 1-[(2S)-2-hydroxycyclobutyl]-3-methylpyridin-2-one |
|---|---|
| PubChem CID | 166507271 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-[(2S)-2-hydroxycyclobutyl]-3-methylpyridin-2-one |
| SMILES | Cc1cccn(C2CC[C@@H]2O)c1=O |
| InChI | InChI=1S/C10H13NO2/c1-7-3-2-6-11(10(7)13)8-4-5-9(8)12/h2-3,6,8-9,12H,4-5H2,1H3/t8?,9-/m0/s1 |
| InChIKey | YDBJEAUPCLFZAO-GKAPJAKFSA-N |
| XLogP | 0.85 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |