C13H16F3NO2 — CID 165490788
1-[5-hydroxy-2-(trifluoromethyl)cyclohexyl]-3-methylpyridin-2-one (PubChem CID 165490788) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 1-[5-hydroxy-2-(trifluoromethyl)cyclohexyl]-3-methylpyridin-2-one.
| Compound Name | 1-[5-hydroxy-2-(trifluoromethyl)cyclohexyl]-3-methylpyridin-2-one |
|---|---|
| PubChem CID | 165490788 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-[5-hydroxy-2-(trifluoromethyl)cyclohexyl]-3-methylpyridin-2-one |
| SMILES | Cc1cccn(C2CC(O)CCC2C(F)(F)F)c1=O |
| InChI | InChI=1S/C13H16F3NO2/c1-8-3-2-6-17(12(8)19)11-7-9(18)4-5-10(11)13(14,15)16/h2-3,6,9-11,18H,4-5,7H2,1H3 |
| InChIKey | IKZYVQSQWBRFHQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |