C23H30N2O5S — CID 137460911
2-methoxyethyl (2R,3R)-3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 137460911) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is 2-methoxyethyl (2R,3R)-3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | 2-methoxyethyl (2R,3R)-3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137460911 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-methoxyethyl (2R,3R)-3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | COCCOC(=O)N1CCC[C@@H](NS(C)(=O)=O)[C@H]1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H30N2O5S/c1-29-14-15-30-23(26)25-13-7-12-21(24-31(2,27)28)22(25)17-18-8-6-11-20(16-18)19-9-4-3-5-10-19/h3-6,8-11,16,21-22,24H,7,12-15,17H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | DSUZLUTUVLUQGL-FGZHOGPDSA-N |
| XLogP | 3.06 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|