C26H28N2O4S — CID 137461708
phenyl 3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 137461708) has the molecular formula C26H28N2O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is phenyl 3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | phenyl 3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137461708 |
| Molecular Formula | C26H28N2O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | phenyl 3-(methanesulfonamido)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)Oc2ccccc2)C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H28N2O4S/c1-33(30,31)27-24-16-9-17-28(26(29)32-23-14-6-3-7-15-23)25(24)19-20-10-8-13-22(18-20)21-11-4-2-5-12-21/h2-8,10-15,18,24-25,27H,9,16-17,19H2,1H3 |
| InChIKey | YAYIBQHEWQNRJK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |