C16H24BrN3O4S — CID 137461196
propan-2-yl (2R,3R)-2-[(6-bromo-2-pyridinyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate (PubChem CID 137461196) has the molecular formula C16H24BrN3O4S and a molecular weight of 434.36 g/mol. Its IUPAC name is propan-2-yl (2R,3R)-2-[(6-bromo-2-pyridinyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate.
| Compound Name | propan-2-yl (2R,3R)-2-[(6-bromo-2-pyridinyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137461196 |
| Molecular Formula | C16H24BrN3O4S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | propan-2-yl (2R,3R)-2-[(6-bromo-2-pyridinyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC[C@@H](NS(C)(=O)=O)[C@H]1Cc1cccc(Br)n1 |
| InChI | InChI=1S/C16H24BrN3O4S/c1-11(2)24-16(21)20-9-5-7-13(19-25(3,22)23)14(20)10-12-6-4-8-15(17)18-12/h4,6,8,11,13-14,19H,5,7,9-10H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | ZJLFHIQZIBILGV-ZIAGYGMSSA-N |
| XLogP | 2.31 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|