C15H21IN2O4S — CID 137460970
methyl (2S,3S)-2-[(3-iodophenyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate (PubChem CID 137460970) has the molecular formula C15H21IN2O4S and a molecular weight of 452.31 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(3-iodophenyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate.
| Compound Name | methyl (2S,3S)-2-[(3-iodophenyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137460970 |
| Molecular Formula | C15H21IN2O4S |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | methyl (2S,3S)-2-[(3-iodophenyl)methyl]-3-(methanesulfonamido)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC[C@H](NS(C)(=O)=O)[C@@H]1Cc1cccc(I)c1 |
| InChI | InChI=1S/C15H21IN2O4S/c1-22-15(19)18-8-4-7-13(17-23(2,20)21)14(18)10-11-5-3-6-12(16)9-11/h3,5-6,9,13-14,17H,4,7-8,10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | GQTCLAVZOCTIAJ-KBPBESRZSA-N |
| XLogP | 1.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|