C22H29N3O4S — CID 137462046
methyl 3-(dimethylsulfamoylamino)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 137462046) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is methyl 3-(dimethylsulfamoylamino)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | methyl 3-(dimethylsulfamoylamino)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137462046 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | methyl 3-(dimethylsulfamoylamino)-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(NS(=O)(=O)N(C)C)C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H29N3O4S/c1-24(2)30(27,28)23-20-13-8-14-25(22(26)29-3)21(20)16-17-9-7-12-19(15-17)18-10-5-4-6-11-18/h4-7,9-12,15,20-21,23H,8,13-14,16H2,1-3H3 |
| InChIKey | UIKVJZLWJPHIKF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |