About S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride
S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride (PubChem CID 137464272) has the molecular formula C10H15ClN2OS
and a molecular weight of 246.76 g/mol. Its IUPAC name is S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride.
Molecular Properties
| Compound Name | S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride |
| PubChem CID | 137464272 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride |
| SMILES | Cl.NC(=O)SC[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C10H14N2OS.ClH/c11-9(7-14-10(12)13)6-8-4-2-1-3-5-8;/h1-5,9H,6-7,11H2,(H2,12,13);1H/t9-;/m1./s1 |
| InChIKey | NONRJGXVVVTIOJ-SBSPUUFOSA-N |
| XLogP | 1.79 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride?
The IUPAC name of S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride (CID 137464272) is S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride.
What is the SMILES notation for S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride?
The canonical SMILES for S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride is Cl.NC(=O)SC[C@H](N)Cc1ccccc1.
What is the InChIKey of S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride?
The InChIKey is NONRJGXVVVTIOJ-SBSPUUFOSA-N. The full InChI is InChI=1S/C10H14N2OS.ClH/c11-9(7-14-10(12)13)6-8-4-2-1-3-5-8;/h1-5,9H,6-7,11H2,(H2,12,13);1H/t9-;/m1./s1.
What are the key properties of S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride?
S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride has a molecular weight of 246.76 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2R)-2-amino-3-phenylpropyl] carbamothioate;hydrochloride is sourced from PubChem (CID 137464272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).