C22H28N4O — CID 137464299
2,5-dimethyl-6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)pyridazin-3-one (PubChem CID 137464299) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2,5-dimethyl-6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)pyridazin-3-one.
| Compound Name | 2,5-dimethyl-6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 137464299 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 2,5-dimethyl-6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)pyridazin-3-one |
| SMILES | Cc1cc(=O)n(C)nc1-c1[nH]c2ccc(C3CCNCC3)cc2c1C(C)C |
| InChI | InChI=1S/C22H28N4O/c1-13(2)20-17-12-16(15-7-9-23-10-8-15)5-6-18(17)24-22(20)21-14(3)11-19(27)26(4)25-21/h5-6,11-13,15,23-24H,7-10H2,1-4H3 |
| InChIKey | SGADBWIWKXIMKT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|