C21H24N6 — CID 142594847
6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 142594847) has the molecular formula C21H24N6 and a molecular weight of 360.47 g/mol. Its IUPAC name is 6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 142594847 |
| Molecular Formula | C21H24N6 |
| Molecular Weight | 360.47 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 6-(5-piperidin-4-yl-3-propan-2-yl-1H-indol-2-yl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CC(C)c1c(-c2ccc3nncn3n2)[nH]c2ccc(C3CCNCC3)cc12 |
| InChI | InChI=1S/C21H24N6/c1-13(2)20-16-11-15(14-7-9-22-10-8-14)3-4-17(16)24-21(20)18-5-6-19-25-23-12-27(19)26-18/h3-6,11-14,22,24H,7-10H2,1-2H3 |
| InChIKey | KOQLQTDNXXQDGE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|