C26H38N2O4 — CID 137465293
(2S)-2-(9-octanoyl-1-oxo-2,9-diazaspiro[4.5]decan-2-yl)-4-phenylbutanoic acid (PubChem CID 137465293) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2S)-2-(9-octanoyl-1-oxo-2,9-diazaspiro[4.5]decan-2-yl)-4-phenylbutanoic acid.
| Compound Name | (2S)-2-(9-octanoyl-1-oxo-2,9-diazaspiro[4.5]decan-2-yl)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 137465293 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (2S)-2-(9-octanoyl-1-oxo-2,9-diazaspiro[4.5]decan-2-yl)-4-phenylbutanoic acid |
| SMILES | CCCCCCCC(=O)N1CCCC2(CCN([C@@H](CCc3ccccc3)C(=O)O)C2=O)C1 |
| InChI | InChI=1S/C26H38N2O4/c1-2-3-4-5-9-13-23(29)27-18-10-16-26(20-27)17-19-28(25(26)32)22(24(30)31)15-14-21-11-7-6-8-12-21/h6-8,11-12,22H,2-5,9-10,13-20H2,1H3,(H,30,31)/t22-,26?/m0/s1 |
| InChIKey | CUJYVXDVHWEOJN-CHQVSRGASA-N |
| XLogP | 4.27 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|