C21H22N8O — CID 137466117
5-[2-[(1R,3S,4R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethoxy]pyrazine-2-carbonitrile (PubChem CID 137466117) has the molecular formula C21H22N8O and a molecular weight of 402.46 g/mol. Its IUPAC name is 5-[2-[(1R,3S,4R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethoxy]pyrazine-2-carbonitrile.
| Compound Name | 5-[2-[(1R,3S,4R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethoxy]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 137466117 |
| Molecular Formula | C21H22N8O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 5-[2-[(1R,3S,4R)-3-ethyl-4-(1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentyl]ethoxy]pyrazine-2-carbonitrile |
| SMILES | CC[C@H]1C[C@@H](CCOc2cnc(C#N)cn2)C[C@H]1c1nnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C21H22N8O/c1-2-14-7-13(4-6-30-19-12-24-15(9-22)10-25-19)8-16(14)21-28-27-18-11-26-20-17(29(18)21)3-5-23-20/h3,5,10-14,16,23H,2,4,6-8H2,1H3/t13-,14+,16-/m1/s1 |
| InChIKey | PYMKDOIDOJLCSS-IJEWVQPXSA-N |
| XLogP | 3.26 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |