C19H24Cl2N4O3 — CID 137468071
5-[3-[4-(3,5-dichloro-2-methylphenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 137468071) has the molecular formula C19H24Cl2N4O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is 5-[3-[4-(3,5-dichloro-2-methylphenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-(3,5-dichloro-2-methylphenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137468071 |
| Molecular Formula | C19H24Cl2N4O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 5-[3-[4-(3,5-dichloro-2-methylphenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1c(Cl)cc(Cl)cc1N1CCN(C(=O)C(C)CC2(C)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C19H24Cl2N4O3/c1-11(10-19(3)17(27)22-18(28)23-19)16(26)25-6-4-24(5-7-25)15-9-13(20)8-14(21)12(15)2/h8-9,11H,4-7,10H2,1-3H3,(H2,22,23,27,28) |
| InChIKey | WQKONALRJRSIEM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|