C21H28Cl2N4O5 — CID 137467905
5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-(2-methoxyethoxymethyl)imidazolidine-2,4-dione (PubChem CID 137467905) has the molecular formula C21H28Cl2N4O5 and a molecular weight of 487.38 g/mol. Its IUPAC name is 5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-(2-methoxyethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-(2-methoxyethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137467905 |
| Molecular Formula | C21H28Cl2N4O5 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-2-methyl-3-oxopropyl]-5-(2-methoxyethoxymethyl)imidazolidine-2,4-dione |
| SMILES | COCCOCC1(CC(C)C(=O)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H28Cl2N4O5/c1-14(12-21(13-32-8-7-31-2)19(29)24-20(30)25-21)18(28)27-5-3-26(4-6-27)17-10-15(22)9-16(23)11-17/h9-11,14H,3-8,12-13H2,1-2H3,(H2,24,25,29,30) |
| InChIKey | VHBXEIWZZYXPHF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|