C17H21Cl2N5O3 — CID 121437901
5-(aminomethyl)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 121437901) has the molecular formula C17H21Cl2N5O3 and a molecular weight of 414.29 g/mol. Its IUPAC name is 5-(aminomethyl)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-(aminomethyl)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121437901 |
| Molecular Formula | C17H21Cl2N5O3 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 5-(aminomethyl)-5-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | NCC1(CCC(=O)N2CCN(c3cc(Cl)cc(Cl)c3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H21Cl2N5O3/c18-11-7-12(19)9-13(8-11)23-3-5-24(6-4-23)14(25)1-2-17(10-20)15(26)21-16(27)22-17/h7-9H,1-6,10,20H2,(H2,21,22,26,27) |
| InChIKey | AHFNCXLUDZUXTJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|