C21H29ClN4O5 — CID 145108957
2-[4-[3-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]acetic acid;ethane (PubChem CID 145108957) has the molecular formula C21H29ClN4O5 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-[4-[3-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]acetic acid;ethane.
| Compound Name | 2-[4-[3-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 145108957 |
| Molecular Formula | C21H29ClN4O5 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 2-[4-[3-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]-3-oxopropyl]-2,5-dioxoimidazolidin-4-yl]acetic acid;ethane |
| SMILES | CC.Cc1cc(N2CCN(C(=O)CCC3(CC(=O)O)NC(=O)NC3=O)CC2)ccc1Cl |
| InChI | InChI=1S/C19H23ClN4O5.C2H6/c1-12-10-13(2-3-14(12)20)23-6-8-24(9-7-23)15(25)4-5-19(11-16(26)27)17(28)21-18(29)22-19;1-2/h2-3,10H,4-9,11H2,1H3,(H,26,27)(H2,21,22,28,29);1-2H3 |
| InChIKey | TWXUPQKASRFOMP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|