C18H21ClFN3O3 — CID 157376376
5-[3-[4-(4-chloro-3-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylpyrrolidine-2,4-dione (PubChem CID 157376376) has the molecular formula C18H21ClFN3O3 and a molecular weight of 381.84 g/mol. Its IUPAC name is 5-[3-[4-(4-chloro-3-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylpyrrolidine-2,4-dione.
| Compound Name | 5-[3-[4-(4-chloro-3-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 157376376 |
| Molecular Formula | C18H21ClFN3O3 |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 5-[3-[4-(4-chloro-3-fluorophenyl)piperazin-1-yl]-3-oxopropyl]-5-methylpyrrolidine-2,4-dione |
| SMILES | CC1(CCC(=O)N2CCN(c3ccc(Cl)c(F)c3)CC2)NC(=O)CC1=O |
| InChI | InChI=1S/C18H21ClFN3O3/c1-18(15(24)11-16(25)21-18)5-4-17(26)23-8-6-22(7-9-23)12-2-3-13(19)14(20)10-12/h2-3,10H,4-9,11H2,1H3,(H,21,25) |
| InChIKey | BKJJUGGRFAILOC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|