C21H25ClFN3O3 — CID 148755454
5-[3-[(3S)-4-(3-chloro-4-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-cyclopropylpyrrolidine-2,4-dione (PubChem CID 148755454) has the molecular formula C21H25ClFN3O3 and a molecular weight of 421.90 g/mol. Its IUPAC name is 5-[3-[(3S)-4-(3-chloro-4-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-cyclopropylpyrrolidine-2,4-dione.
| Compound Name | 5-[3-[(3S)-4-(3-chloro-4-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-cyclopropylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 148755454 |
| Molecular Formula | C21H25ClFN3O3 |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-[3-[(3S)-4-(3-chloro-4-fluorophenyl)-3-methylpiperazin-1-yl]-3-oxopropyl]-5-cyclopropylpyrrolidine-2,4-dione |
| SMILES | C[C@H]1CN(C(=O)CCC2(C3CC3)NC(=O)CC2=O)CCN1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H25ClFN3O3/c1-13-12-25(8-9-26(13)15-4-5-17(23)16(22)10-15)20(29)6-7-21(14-2-3-14)18(27)11-19(28)24-21/h4-5,10,13-14H,2-3,6-9,11-12H2,1H3,(H,24,28)/t13-,21?/m0/s1 |
| InChIKey | OFMXYVLOPSKAQJ-JRTLGTJJSA-N |
| XLogP | 2.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|