C21H24FN5O3 — CID 121437613
3-[(2S)-4-[3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoyl]-2-methylpiperazin-1-yl]-5-fluorobenzonitrile (PubChem CID 121437613) has the molecular formula C21H24FN5O3 and a molecular weight of 413.45 g/mol. Its IUPAC name is 3-[(2S)-4-[3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoyl]-2-methylpiperazin-1-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[(2S)-4-[3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoyl]-2-methylpiperazin-1-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 121437613 |
| Molecular Formula | C21H24FN5O3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 3-[(2S)-4-[3-(4-cyclopropyl-2,5-dioxoimidazolidin-4-yl)propanoyl]-2-methylpiperazin-1-yl]-5-fluorobenzonitrile |
| SMILES | C[C@H]1CN(C(=O)CCC2(C3CC3)NC(=O)NC2=O)CCN1c1cc(F)cc(C#N)c1 |
| InChI | InChI=1S/C21H24FN5O3/c1-13-12-26(6-7-27(13)17-9-14(11-23)8-16(22)10-17)18(28)4-5-21(15-2-3-15)19(29)24-20(30)25-21/h8-10,13,15H,2-7,12H2,1H3,(H2,24,25,29,30)/t13-,21?/m0/s1 |
| InChIKey | YOLARCCEGZOTQI-JRTLGTJJSA-N |
| XLogP | 1.50 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|